Products 1094306-31-6
CAS 1094306-31-6 is the registry number for 4-Chloro-N-(2-(thiophen-2-yl)ethyl)picolinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(2-thiophen-2-ylethyl)pyridine-2-carboxamide (CAS 1094306-31-6) is a chemical compound with the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. IUPAC name: 4-chloro-N-(2-thiophen-2-ylethyl)pyridine-2-carboxamide. InChIKey: XXZBVGGBUYZIOG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2OS |
|---|---|
| Molecular weight | 266.75 g/mol |
| IUPAC name | 4-chloro-N-(2-thiophen-2-ylethyl)pyridine-2-carboxamide |
| InChIKey | XXZBVGGBUYZIOG-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CCNC(=O)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)