Products 58905-44-5
CAS 58905-44-5 is the registry number for N-[4-(Chloromethyl)-1,3-thiazol-2-yl]-n-phenylacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-phenylacetamide (CAS 58905-44-5) is a chemical compound with the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. IUPAC name: N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-phenylacetamide. InChIKey: ZVNIZGVXMHETAB-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2OS |
|---|---|
| Molecular weight | 266.75 g/mol |
| IUPAC name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-phenylacetamide |
| InChIKey | ZVNIZGVXMHETAB-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1=CC=CC=C1)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)