Products 50772-64-0
CAS 50772-64-0 is the registry number for 2-Chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide (CAS 50772-64-0) is a chemical compound with the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. IUPAC name: 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide. InChIKey: ANTVEXRUHJVROA-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2OS |
|---|---|
| Molecular weight | 266.75 g/mol |
| IUPAC name | 2-chloro-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide |
| InChIKey | ANTVEXRUHJVROA-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)N(C2=CC=CC=C2)C(=O)CCl |
Computed by PubChem (NCBI)