CAS 2137936-69-5 is the registry number for 5-​Imino-​10H-​phenothiazine 5-​oxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-imino-10H-phenothiazine 5-oxide;hydrochloride (CAS 2137936-69-5) is a chemical compound with the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. IUPAC name: 5-imino-10H-phenothiazine 5-oxide;hydrochloride. InChIKey: GBLVGNNGAUFOSJ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2OS |
|---|---|
| Molecular weight | 266.75 g/mol |
| IUPAC name | 5-imino-10H-phenothiazine 5-oxide;hydrochloride |
| InChIKey | GBLVGNNGAUFOSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=CC=CC=C3S2(=N)=O.Cl |
Computed by PubChem (NCBI)