CAS 1094318-26-9 appears in our catalog under these names: 4-(2-(Chloromethyl)-1,3-oxazol-5-yl)benzonitrile, 95%, 4-(2-(Chloromethyl)-1,3-oxazol-5-yl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-[2-(chloromethyl)-1,3-oxazol-5-yl]benzonitrile (CAS 1094318-26-9) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 4-[2-(chloromethyl)-1,3-oxazol-5-yl]benzonitrile. InChIKey: DRIHTYRPTAJGOS-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-[2-(chloromethyl)-1,3-oxazol-5-yl]benzonitrile |
| InChIKey | DRIHTYRPTAJGOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CN=C(O2)CCl |
Computed by PubChem (NCBI)