Products 1094326-04-1
CAS 1094326-04-1 is the registry number for N-Ethyl-4-hydroxy-3-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-ethyl-4-hydroxy-3-nitrobenzenesulfonamide (CAS 1094326-04-1) is a chemical compound with the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. IUPAC name: N-ethyl-4-hydroxy-3-nitrobenzenesulfonamide. InChIKey: UQMRLBVAKNCFJM-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O5S |
|---|---|
| Molecular weight | 246.24 g/mol |
| IUPAC name | N-ethyl-4-hydroxy-3-nitrobenzenesulfonamide |
| InChIKey | UQMRLBVAKNCFJM-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC(=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)