CAS 92259-24-0 is the registry number for 5-(1,1-Dioxidotetrahydrothien-3-yl)pyrimidine-2,4,6(1H,3H,5H)-trione. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(1,1-dioxothiolan-3-yl)-1,3-diazinane-2,4,6-trione (CAS 92259-24-0) is a chemical compound with the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. IUPAC name: 5-(1,1-dioxothiolan-3-yl)-1,3-diazinane-2,4,6-trione. InChIKey: PVCCLOHQNJTLFO-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O5S |
|---|---|
| Molecular weight | 246.24 g/mol |
| IUPAC name | 5-(1,1-dioxothiolan-3-yl)-1,3-diazinane-2,4,6-trione |
| InChIKey | PVCCLOHQNJTLFO-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1C2C(=O)NC(=O)NC2=O |
Computed by PubChem (NCBI)