CAS 1094332-66-7 is the registry number for N-Cyclohexyl 4-chloropicolinamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-chloro-N-cyclohexylpyridine-2-carboxamide (CAS 1094332-66-7) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: 4-chloro-N-cyclohexylpyridine-2-carboxamide. InChIKey: NXWNXOZYZLEOGK-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 4-chloro-N-cyclohexylpyridine-2-carboxamide |
| InChIKey | NXWNXOZYZLEOGK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)