CAS 1094364-33-6 is the registry number for Methyl 2-(3-(2-chloroacetyl)-2,5-dimethyl-1H-pyrrol-1-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]acetate (CAS 1094364-33-6) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: methyl 2-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]acetate. InChIKey: GREGJLWAOFZOPE-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | methyl 2-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]acetate |
| InChIKey | GREGJLWAOFZOPE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC(=O)OC)C)C(=O)CCl |
Computed by PubChem (NCBI)