Products 1094364-33-6

CAS 1094364-33-6 is the registry number for Methyl 2-(3-(2-chloroacetyl)-2,5-dimethyl-1H-pyrrol-1-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]acetate (CAS 1094364-33-6) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: methyl 2-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]acetate. InChIKey: GREGJLWAOFZOPE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO3
Molecular weight243.68 g/mol
IUPAC namemethyl 2-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]acetate
InChIKeyGREGJLWAOFZOPE-UHFFFAOYSA-N
SMILESCC1=CC(=C(N1CC(=O)OC)C)C(=O)CCl

Computed by PubChem (NCBI)