CAS 1094398-45-4 appears in our catalog under these names: Methyl 3-amino-5-(3-bromophenyl)thiophene-2-carboxylate, 95%, Methyl 3-amino-5-(3-bromophenyl)thiophene-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Methyl 3-amino-5-(3-bromophenyl)thiophene-2-carboxylate (CAS 1094398-45-4) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: methyl 3-amino-5-(3-bromophenyl)thiophene-2-carboxylate. InChIKey: YTJTVXOJLZLQGQ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | methyl 3-amino-5-(3-bromophenyl)thiophene-2-carboxylate |
| InChIKey | YTJTVXOJLZLQGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)