CAS 1094411-96-7 appears in our catalog under these names: 2-(2-tert-Butyl-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-tert-Butyl-1,3-thiazol-4-yl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 250mg, 5g, 1g.
2-(2-tert-butyl-1,3-thiazol-4-yl)acetic acid (CAS 1094411-96-7) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2-(2-tert-butyl-1,3-thiazol-4-yl)acetic acid. InChIKey: AOJJREQRLZDBAA-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2-(2-tert-butyl-1,3-thiazol-4-yl)acetic acid |
| InChIKey | AOJJREQRLZDBAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=CS1)CC(=O)O |
Computed by PubChem (NCBI)