Products 1094424-37-9

CAS 1094424-37-9 is the registry number for 1-(4-Bromo-2,5-dimethoxybenzyl)piperazine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 10mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

1-[(4-bromo-2,5-dimethoxyphenyl)methyl]piperazine (CAS 1094424-37-9) is a chemical compound with the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. IUPAC name: 1-[(4-bromo-2,5-dimethoxyphenyl)methyl]piperazine. InChIKey: OHXVYXBOJDDYJS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19BrN2O2
Molecular weight315.21 g/mol
IUPAC name1-[(4-bromo-2,5-dimethoxyphenyl)methyl]piperazine
InChIKeyOHXVYXBOJDDYJS-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1CN2CCNCC2)OC)Br

Computed by PubChem (NCBI)