CAS 1609409-25-7 is the registry number for N-(4-Nitrobenzyl)cyclohexanamine hydrobromide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-[(4-nitrophenyl)methyl]cyclohexanamine;hydrobromide (CAS 1609409-25-7) is a chemical compound with the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. IUPAC name: N-[(4-nitrophenyl)methyl]cyclohexanamine;hydrobromide. InChIKey: SPEHVZSHPCIDIN-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN2O2 |
|---|---|
| Molecular weight | 315.21 g/mol |
| IUPAC name | N-[(4-nitrophenyl)methyl]cyclohexanamine;hydrobromide |
| InChIKey | SPEHVZSHPCIDIN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NCC2=CC=C(C=C2)[N+](=O)[O-].Br |
Computed by PubChem (NCBI)