Products 2206608-81-1
CAS 2206608-81-1 is the registry number for 5-Bromo-2-isopropylamino-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 5-bromo-2-(propan-2-ylamino)pyridine-3-carboxylate (CAS 2206608-81-1) is a chemical compound with the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. IUPAC name: tert-butyl 5-bromo-2-(propan-2-ylamino)pyridine-3-carboxylate. InChIKey: XVBXVNYTFVQBOH-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN2O2 |
|---|---|
| Molecular weight | 315.21 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-(propan-2-ylamino)pyridine-3-carboxylate |
| InChIKey | XVBXVNYTFVQBOH-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=C(C=N1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)