CAS 1628106-73-9 is the registry number for (S)-tert-Butyl (1-(5-bromo-4-methylpyridin-2-yl)ethyl)carbamate, 97%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
Tert-butyl N-[(1S)-1-(5-bromo-4-methyl-2-pyridinyl)ethyl]carbamate (CAS 1628106-73-9) is a chemical compound with the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. IUPAC name: tert-butyl N-[(1S)-1-(5-bromo-4-methyl-2-pyridinyl)ethyl]carbamate. InChIKey: HTYAJBOAMRQSSE-VIFPVBQESA-N.
| Molecular formula | C13H19BrN2O2 |
|---|---|
| Molecular weight | 315.21 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-(5-bromo-4-methyl-2-pyridinyl)ethyl]carbamate |
| InChIKey | HTYAJBOAMRQSSE-VIFPVBQESA-N |
| SMILES | CC1=CC(=NC=C1Br)[C@H](C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)