CAS 1094639-91-4 is the registry number for 3-(1-Benzothiophene-3-carbonyl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-benzothiophen-3-yl(pyridin-3-yl)methanone (CAS 1094639-91-4) is a chemical compound with the molecular formula C14H9NOS and a molecular weight of 239.29 g/mol. IUPAC name: 1-benzothiophen-3-yl(pyridin-3-yl)methanone. InChIKey: RZWKYRKNEPYDED-UHFFFAOYSA-N.
| Molecular formula | C14H9NOS |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 1-benzothiophen-3-yl(pyridin-3-yl)methanone |
| InChIKey | RZWKYRKNEPYDED-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)