CAS 87736-73-0 is the registry number for 2-(phenylcarbonyl)-3-(2-thienyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-benzoyl-3-thiophen-2-ylprop-2-enenitrile (CAS 87736-73-0) is a chemical compound with the molecular formula C14H9NOS and a molecular weight of 239.29 g/mol. IUPAC name: (E)-2-benzoyl-3-thiophen-2-ylprop-2-enenitrile. InChIKey: GBBWQFWDULNWTL-FMIVXFBMSA-N.
| Molecular formula | C14H9NOS |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | (E)-2-benzoyl-3-thiophen-2-ylprop-2-enenitrile |
| InChIKey | GBBWQFWDULNWTL-FMIVXFBMSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C(=C/C2=CC=CS2)/C#N |
Computed by PubChem (NCBI)