Products 383140-93-0
CAS 383140-93-0 is the registry number for 4-(Naphthalen-2-yl)-1,3-thiazole-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 10g, 1g.
4-naphthalen-2-yl-1,3-thiazole-2-carbaldehyde (CAS 383140-93-0) is a chemical compound with the molecular formula C14H9NOS and a molecular weight of 239.29 g/mol. IUPAC name: 4-naphthalen-2-yl-1,3-thiazole-2-carbaldehyde. InChIKey: WSHIFWGDBKTJFQ-UHFFFAOYSA-N.
| Molecular formula | C14H9NOS |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 4-naphthalen-2-yl-1,3-thiazole-2-carbaldehyde |
| InChIKey | WSHIFWGDBKTJFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CSC(=N3)C=O |
Computed by PubChem (NCBI)