CAS 26328-59-6 is the registry number for Methanone, (4-isothiocyanatophenyl)phenyl-, 90%, 90%. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
(4-isothiocyanatophenyl)-phenylmethanone (CAS 26328-59-6) is a chemical compound with the molecular formula C14H9NOS and a molecular weight of 239.29 g/mol. IUPAC name: (4-isothiocyanatophenyl)-phenylmethanone. InChIKey: FMSYGGOEIOBUOR-UHFFFAOYSA-N.
| Molecular formula | C14H9NOS |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | (4-isothiocyanatophenyl)-phenylmethanone |
| InChIKey | FMSYGGOEIOBUOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)