Products 109471-13-8
CAS 109471-13-8 is the registry number for 3'-Methyl-4-o-methylhelichrysetin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(E)-1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 109471-13-8) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: (E)-1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: OVJIHSNZSOFRQU-RMKNXTFCSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | (E)-1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | OVJIHSNZSOFRQU-RMKNXTFCSA-N |
| SMILES | CC1=C(C(=C(C=C1O)OC)C(=O)/C=C/C2=CC=C(C=C2)OC)O |
Computed by PubChem (NCBI)