Products 1094765-75-9
CAS 1094765-75-9 is the registry number for N-(2-(3-Bromophenoxy)acetyl)-N-methylglycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[2-(3-bromophenoxy)acetyl]-methylamino]acetic acid (CAS 1094765-75-9) is a chemical compound with the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. IUPAC name: 2-[[2-(3-bromophenoxy)acetyl]-methylamino]acetic acid. InChIKey: PUWIJAFLXBMCBK-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO4 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 2-[[2-(3-bromophenoxy)acetyl]-methylamino]acetic acid |
| InChIKey | PUWIJAFLXBMCBK-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C(=O)COC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)