CAS 590357-01-0 is the registry number for 2-(2-Bromo-6-ethoxy-4-formylphenoxy)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2-bromo-6-ethoxy-4-formylphenoxy)acetamide (CAS 590357-01-0) is a chemical compound with the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. IUPAC name: 2-(2-bromo-6-ethoxy-4-formylphenoxy)acetamide. InChIKey: HPGNIWDIBHPWNQ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO4 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 2-(2-bromo-6-ethoxy-4-formylphenoxy)acetamide |
| InChIKey | HPGNIWDIBHPWNQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Br)OCC(=O)N |
Computed by PubChem (NCBI)