CAS 524956-08-9 is the registry number for 2-Bromo-4-nitro-benzoic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2-bromo-4-nitrobenzoate (CAS 524956-08-9) is a chemical compound with the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. IUPAC name: tert-butyl 2-bromo-4-nitrobenzoate. InChIKey: BPMARSAPCROSJI-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO4 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | tert-butyl 2-bromo-4-nitrobenzoate |
| InChIKey | BPMARSAPCROSJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)