CAS 544709-66-2 is the registry number for Methyl 2-(4-bromo-2-nitrophenyl)-2-methylpropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-(4-bromo-2-nitrophenyl)-2-methylpropanoate (CAS 544709-66-2) is a chemical compound with the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. IUPAC name: methyl 2-(4-bromo-2-nitrophenyl)-2-methylpropanoate. InChIKey: HBDWMFVPZMFMOD-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO4 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | methyl 2-(4-bromo-2-nitrophenyl)-2-methylpropanoate |
| InChIKey | HBDWMFVPZMFMOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1)Br)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)