CAS 1094791-41-9 is the registry number for (2,5-Dichlorophenyl)(phenyl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2,5-dichlorophenyl)-phenylmethanol (CAS 1094791-41-9) is a chemical compound with the molecular formula C13H10Cl2O and a molecular weight of 253.12 g/mol. IUPAC name: (2,5-dichlorophenyl)-phenylmethanol. InChIKey: VHEZPOVNYSYUFJ-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-phenylmethanol |
| InChIKey | VHEZPOVNYSYUFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)