CAS 1375068-81-7 is the registry number for 1,3-Dichloro-5-(3-methoxyphenyl)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3-dichloro-5-(3-methoxyphenyl)benzene (CAS 1375068-81-7) is a chemical compound with the molecular formula C13H10Cl2O and a molecular weight of 253.12 g/mol. IUPAC name: 1,3-dichloro-5-(3-methoxyphenyl)benzene. InChIKey: DZWVUJBVFSVBKU-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 1,3-dichloro-5-(3-methoxyphenyl)benzene |
| InChIKey | DZWVUJBVFSVBKU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)