CAS 1094904-92-3 appears in our catalog under these names: 4-Amino-2-methoxy-N-methylbenzene-1-sulfonamide, 95%, 4-Amino-2-methoxy-N-methylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-amino-2-methoxy-N-methylbenzenesulfonamide (CAS 1094904-92-3) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: 4-amino-2-methoxy-N-methylbenzenesulfonamide. InChIKey: FGXLWAXAUSOKJK-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 4-amino-2-methoxy-N-methylbenzenesulfonamide |
| InChIKey | FGXLWAXAUSOKJK-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C=C(C=C1)N)OC |
Computed by PubChem (NCBI)