CAS 109493-60-9 appears in our catalog under these names: N-(3-Toyl)barbituric Acid, 1-(3-Methylphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione (CAS 109493-60-9) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione. InChIKey: KBLDDZJBNOUYGS-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | KBLDDZJBNOUYGS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)CC(=O)NC2=O |
Computed by PubChem (NCBI)