Products 1094937-81-1
CAS 1094937-81-1 appears in our catalog under these names: 4-((7-Chloroquinolin-4-yl)oxy)-3-fluoroaniline, 4-[(7-Chloroquinolin-4-yl)oxy]-3-fluoroaniline 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 250mg, 2,5g, 100mg.
4-(7-chloroquinolin-4-yl)oxy-3-fluoroaniline (CAS 1094937-81-1) is a chemical compound with the molecular formula C15H10ClFN2O and a molecular weight of 288.70 g/mol. IUPAC name: 4-(7-chloroquinolin-4-yl)oxy-3-fluoroaniline. InChIKey: VSNSWGXNBFVTMB-UHFFFAOYSA-N.
| Molecular formula | C15H10ClFN2O |
|---|---|
| Molecular weight | 288.70 g/mol |
| IUPAC name | 4-(7-chloroquinolin-4-yl)oxy-3-fluoroaniline |
| InChIKey | VSNSWGXNBFVTMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)OC2=C3C=CC(=CC3=NC=C2)Cl |
Computed by PubChem (NCBI)