CAS 1097153-49-5 is the registry number for 4-(4-Chlorophenyl)-3-(4-fluorophenyl)-1,2-oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(4-chlorophenyl)-3-(4-fluorophenyl)-1,2-oxazol-5-amine (CAS 1097153-49-5) is a chemical compound with the molecular formula C15H10ClFN2O and a molecular weight of 288.70 g/mol. IUPAC name: 4-(4-chlorophenyl)-3-(4-fluorophenyl)-1,2-oxazol-5-amine. InChIKey: UJZHVJQQPYUTDU-UHFFFAOYSA-N.
| Molecular formula | C15H10ClFN2O |
|---|---|
| Molecular weight | 288.70 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3-(4-fluorophenyl)-1,2-oxazol-5-amine |
| InChIKey | UJZHVJQQPYUTDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2C3=CC=C(C=C3)Cl)N)F |
Computed by PubChem (NCBI)