CAS 1095051-79-8 appears in our catalog under these names: 4-(2-Fluorophenyl)-2,3-dihydro-1,3-thiazol-2-one, 95%, BRD4 Inhibitor 30/ 99.68% (existing batch purity), 4-(2-Fluorophenyl)-2,3-dihydro-1,3-thiazol-2-one, BRD4 Inhibitor-37. Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
4-(2-fluorophenyl)-3H-1,3-thiazol-2-one (CAS 1095051-79-8) is a chemical compound with the molecular formula C9H6FNOS and a molecular weight of 195.22 g/mol. IUPAC name: 4-(2-fluorophenyl)-3H-1,3-thiazol-2-one. InChIKey: WPBUAOKGWQBCMU-UHFFFAOYSA-N.
| Molecular formula | C9H6FNOS |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-3H-1,3-thiazol-2-one |
| InChIKey | WPBUAOKGWQBCMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=O)N2)F |
Computed by PubChem (NCBI)