CAS 834885-06-2 is the registry number for 4-(4-Fluorophenyl)thiazol-2-ol, 95+%. Offered by: AmBeed. Available pack sizes: 10g.
4-(4-fluorophenyl)-3H-1,3-thiazol-2-one (CAS 834885-06-2) is a chemical compound with the molecular formula C9H6FNOS and a molecular weight of 195.22 g/mol. IUPAC name: 4-(4-fluorophenyl)-3H-1,3-thiazol-2-one. InChIKey: VDFFNDUNESKYCU-UHFFFAOYSA-N.
| Molecular formula | C9H6FNOS |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-3H-1,3-thiazol-2-one |
| InChIKey | VDFFNDUNESKYCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=O)N2)F |
Computed by PubChem (NCBI)