CAS 1095110-42-1 appears in our catalog under these names: 4-(3-Fluorophenyl)-2,3-dihydro-1,3-thiazol-2-one, 95%, 4-(3-Fluorophenyl)-2,3-dihydro-1,3-thiazol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
4-(3-fluorophenyl)-3H-1,3-thiazol-2-one (CAS 1095110-42-1) is a chemical compound with the molecular formula C9H6FNOS and a molecular weight of 195.22 g/mol. IUPAC name: 4-(3-fluorophenyl)-3H-1,3-thiazol-2-one. InChIKey: QGYIVYQOWUOKBC-UHFFFAOYSA-N.
| Molecular formula | C9H6FNOS |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 4-(3-fluorophenyl)-3H-1,3-thiazol-2-one |
| InChIKey | QGYIVYQOWUOKBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CSC(=O)N2 |
Computed by PubChem (NCBI)