CAS 923218-69-3 appears in our catalog under these names: 5-(4-Fluorophenyl)-1,3-oxazole-2-thiol, 95%, 5-(4-Fluorophenyl)-1,3-oxazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione (CAS 923218-69-3) is a chemical compound with the molecular formula C9H6FNOS and a molecular weight of 195.22 g/mol. IUPAC name: 5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione. InChIKey: DPACSQVMBJOBAK-UHFFFAOYSA-N.
| Molecular formula | C9H6FNOS |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-3H-1,3-oxazole-2-thione |
| InChIKey | DPACSQVMBJOBAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC(=S)O2)F |
Computed by PubChem (NCBI)