Products 109524-10-9
CAS 109524-10-9 appears in our catalog under these names: 1,3-Dioxoisoindolin-2-yl 2-phenoxyacetate, 97%, 97%, 1,3-Dioxoisoindolin-2-yl 2-phenoxyacetate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
(1,3-dioxoisoindol-2-yl) 2-phenoxyacetate (CAS 109524-10-9) is a chemical compound with the molecular formula C16H11NO5 and a molecular weight of 297.26 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-phenoxyacetate. InChIKey: UCRNUJBOZZEJOR-UHFFFAOYSA-N.
| Molecular formula | C16H11NO5 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-phenoxyacetate |
| InChIKey | UCRNUJBOZZEJOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)