Products 109592-60-1
CAS 109592-60-1 appears in our catalog under these names: Pinocembrin 7-acetate, Pinocembrin, 7-acetate, Pinocembrin 7-acetate, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 1 mg, 5 mg, 20mg.
[(2S)-5-hydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate (CAS 109592-60-1) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: [(2S)-5-hydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate. InChIKey: OCRUXLYEKHXKPB-HNNXBMFYSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | [(2S)-5-hydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate |
| InChIKey | OCRUXLYEKHXKPB-HNNXBMFYSA-N |
| SMILES | CC(=O)OC1=CC(=C2C(=O)C[C@H](OC2=C1)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)