CAS 1313738-76-9 is the registry number for 2-(3,4-Dihydroxyphenyl)-6-ethyl-3-hydroxychromen-4-one, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-(3,4-dihydroxyphenyl)-6-ethyl-3-hydroxychromen-4-one (CAS 1313738-76-9) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-6-ethyl-3-hydroxychromen-4-one. InChIKey: SQVMXCHFANPQEF-UHFFFAOYSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-6-ethyl-3-hydroxychromen-4-one |
| InChIKey | SQVMXCHFANPQEF-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)