CAS 1353119-31-9 is the registry number for (2Z)-2-(2,3-Dimethoxybenzylidene)-6-hydroxy-1-benzofuran-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (CAS 1353119-31-9) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: (2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one. InChIKey: GQSYGPPHMQKVOE-NVNXTCNLSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | (2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| InChIKey | GQSYGPPHMQKVOE-NVNXTCNLSA-N |
| SMILES | COC1=CC=CC(=C1OC)/C=C\2/C(=O)C3=C(O2)C=C(C=C3)O |
Computed by PubChem (NCBI)