CAS 1322574-14-0 is the registry number for (2Z)-2-(3,4-Dimethoxybenzylidene)-6-hydroxy-1-benzofuran-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (CAS 1322574-14-0) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one. InChIKey: YUCCNWHJQXNUQE-PXNMLYILSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| InChIKey | YUCCNWHJQXNUQE-PXNMLYILSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\2/C(=O)C3=C(O2)C=C(C=C3)O)OC |
Computed by PubChem (NCBI)