Products 109605-79-0
CAS 109605-79-0 is the registry number for Topazolin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
5,7-dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-6-(3-methylbut-2-enyl)chromen-4-one (CAS 109605-79-0) is a chemical compound with the molecular formula C21H20O6 and a molecular weight of 368.4 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-6-(3-methylbut-2-enyl)chromen-4-one. InChIKey: VVXGFIWLFZMBCJ-UHFFFAOYSA-N.
| Molecular formula | C21H20O6 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-6-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | VVXGFIWLFZMBCJ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)OC(=C(C2=O)OC)C3=CC=C(C=C3)O)O)C |
Computed by PubChem (NCBI)