CAS 1096155-68-8 appears in our catalog under these names: (1S,3R)-3-aminocyclopentane-1-carboxylic acid hydrochloride, 95%, (1S,3R)-3-Aminocyclopentanecarboxylic acid hydrochloride, 98%, (1S,3R)–3–Aminocyclopentanecarboxylic acid hydrochloride, (1S,3R)-3-Aminocyclopentanecarboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Cis-(1S,3R)-3-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 1096155-68-8) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: cis-(1S,3R)-3-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: YJRMNPPUVLZEIJ-UYXJWNHNSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | cis-(1S,3R)-3-aminocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | YJRMNPPUVLZEIJ-UYXJWNHNSA-N |
| SMILES | C1C[C@H](C[C@H]1C(=O)O)N.Cl |
Computed by PubChem (NCBI)