CAS 2243913-36-0 appears in our catalog under these names: (1S,3S)-3-Aminocyclopentane-1-carboxylic acid hydrochloride, 95%, (1S,3S)–3–Aminocyclopentanecarboxylic acid hydrochloride, (1S,3S)-3-Aminocyclopentanecarboxylic acid hydrochloride, 97%, 97%, (1S,3S)-3-Aminocyclopentanecarboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
Trans-(1S,3S)-3-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 2243913-36-0) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: trans-(1S,3S)-3-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: YJRMNPPUVLZEIJ-FHAQVOQBSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | trans-(1S,3S)-3-aminocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | YJRMNPPUVLZEIJ-FHAQVOQBSA-N |
| SMILES | C1C[C@@H](C[C@H]1C(=O)O)N.Cl |
Computed by PubChem (NCBI)