Products 1096330-27-6

CAS 1096330-27-6 is the registry number for 4-Amino-3-isobutoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-amino-3-(2-methylpropoxy)benzoic acid (CAS 1096330-27-6) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 4-amino-3-(2-methylpropoxy)benzoic acid. InChIKey: RHANMGQCCAEIOD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO3
Molecular weight209.24 g/mol
IUPAC name4-amino-3-(2-methylpropoxy)benzoic acid
InChIKeyRHANMGQCCAEIOD-UHFFFAOYSA-N
SMILESCC(C)COC1=C(C=CC(=C1)C(=O)O)N

Computed by PubChem (NCBI)