Products 1096794-02-3
CAS 1096794-02-3 is the registry number for 2-((4-Amino-2-chlorophenyl)formamido)-N,N-dimethylacetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-2-chloro-N-[2-(dimethylamino)-2-oxoethyl]benzamide (CAS 1096794-02-3) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: 4-amino-2-chloro-N-[2-(dimethylamino)-2-oxoethyl]benzamide. InChIKey: GOVKKDXOFIKMTQ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 4-amino-2-chloro-N-[2-(dimethylamino)-2-oxoethyl]benzamide |
| InChIKey | GOVKKDXOFIKMTQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CNC(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)