CAS 1096864-14-0 appears in our catalog under these names: 3-Amino-4-((3-methyl-2,5-dioxoimidazolidin-1-yl)methyl)benzamide, 95%, 3-Amino-4-((3-methyl-2,5-dioxoimidazolidin-1-yl)methyl)benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-4-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]benzamide (CAS 1096864-14-0) is a chemical compound with the molecular formula C12H14N4O3 and a molecular weight of 262.26 g/mol. IUPAC name: 3-amino-4-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]benzamide. InChIKey: WKTRMDQSILHKDP-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O3 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 3-amino-4-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| InChIKey | WKTRMDQSILHKDP-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N(C1=O)CC2=C(C=C(C=C2)C(=O)N)N |
Computed by PubChem (NCBI)