CAS 953717-77-6 is the registry number for N-(4-Aminophenyl)-3-(2,5-dioxoimidazolidin-1-yl)propanamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(4-aminophenyl)-3-(2,5-dioxoimidazolidin-1-yl)propanamide (CAS 953717-77-6) is a chemical compound with the molecular formula C12H14N4O3 and a molecular weight of 262.26 g/mol. IUPAC name: N-(4-aminophenyl)-3-(2,5-dioxoimidazolidin-1-yl)propanamide. InChIKey: BYGBDHLJJUFZCG-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O3 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | N-(4-aminophenyl)-3-(2,5-dioxoimidazolidin-1-yl)propanamide |
| InChIKey | BYGBDHLJJUFZCG-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)CCC(=O)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)