CAS 790232-40-5 is the registry number for {(5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl)methyl}(propan-2-yl)amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-2-amine (CAS 790232-40-5) is a chemical compound with the molecular formula C12H14N4O3 and a molecular weight of 262.26 g/mol. IUPAC name: N-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-2-amine. InChIKey: TXDLSMAXHAWDLV-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O3 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | N-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-2-amine |
| InChIKey | TXDLSMAXHAWDLV-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=NN=C(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)