CAS 305354-90-9 is the registry number for 3-(3,4-Dimethoxyphenyl)-1h-pyrazole-5-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carbohydrazide (CAS 305354-90-9) is a chemical compound with the molecular formula C12H14N4O3 and a molecular weight of 262.26 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carbohydrazide. InChIKey: UKZMUSHNNHBWJV-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O3 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1H-pyrazole-5-carbohydrazide |
| InChIKey | UKZMUSHNNHBWJV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NNC(=C2)C(=O)NN)OC |
Computed by PubChem (NCBI)