Products 1096911-74-8
CAS 1096911-74-8 is the registry number for 1-(4-tert-Butylphenyl)-5-propyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-tert-butylphenyl)-5-propyltriazole-4-carboxylic acid (CAS 1096911-74-8) is a chemical compound with the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-5-propyltriazole-4-carboxylic acid. InChIKey: ZSKOKBNRKBONJR-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O2 |
|---|---|
| Molecular weight | 287.36 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-5-propyltriazole-4-carboxylic acid |
| InChIKey | ZSKOKBNRKBONJR-UHFFFAOYSA-N |
| SMILES | CCCC1=C(N=NN1C2=CC=C(C=C2)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)