Products 1096914-22-5
CAS 1096914-22-5 appears in our catalog under these names: 2–(2–Chlorophenyl)–1–(1H–indol–3–yl)ethanone, 2-(2-Chlorophenyl)-1-(1H-indol-3-yl)ethanone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 5 mg, 1 mg.
2-(2-chlorophenyl)-1-(1H-indol-3-yl)ethanone (CAS 1096914-22-5) is a chemical compound with the molecular formula C16H12ClNO and a molecular weight of 269.72 g/mol. IUPAC name: 2-(2-chlorophenyl)-1-(1H-indol-3-yl)ethanone. InChIKey: BDKUJJRMQWUXCD-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1-(1H-indol-3-yl)ethanone |
| InChIKey | BDKUJJRMQWUXCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)C2=CNC3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)